C6H10N4S — CID 15578938
5-methylsulfanyl-1-prop-2-enyl-1,2,4-triazol-3-amine (PubChem CID 15578938) has the molecular formula C6H10N4S and a molecular weight of 170.24 g/mol. Its IUPAC name is 5-methylsulfanyl-1-prop-2-enyl-1,2,4-triazol-3-amine.
| Compound Name | 5-methylsulfanyl-1-prop-2-enyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 15578938 |
| Molecular Formula | C6H10N4S |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 5-methylsulfanyl-1-prop-2-enyl-1,2,4-triazol-3-amine |
| SMILES | C=CCn1nc(N)nc1SC |
| InChI | InChI=1S/C6H10N4S/c1-3-4-10-6(11-2)8-5(7)9-10/h3H,1,4H2,2H3,(H2,7,9) |
| InChIKey | AIHXVOVJJVPAGU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|