C6H10N4 — CID 175870952
1-prop-2-enylpyrazole-3,5-diamine (PubChem CID 175870952) has the molecular formula C6H10N4 and a molecular weight of 138.17 g/mol. Its IUPAC name is 1-prop-2-enylpyrazole-3,5-diamine.
| Compound Name | 1-prop-2-enylpyrazole-3,5-diamine |
|---|---|
| PubChem CID | 175870952 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 1-prop-2-enylpyrazole-3,5-diamine |
| SMILES | C=CCn1nc(N)cc1N |
| InChI | InChI=1S/C6H10N4/c1-2-3-10-6(8)4-5(7)9-10/h2,4H,1,3,8H2,(H2,7,9) |
| InChIKey | HNWGIGYQQKLANM-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|