About 1-prop-2-enylpyrazole-4,5-diamine
1-prop-2-enylpyrazole-4,5-diamine (PubChem CID 67655592) has the molecular formula C6H10N4
and a molecular weight of 138.17 g/mol. Its IUPAC name is 1-prop-2-enylpyrazole-4,5-diamine.
Molecular Properties
| Compound Name | 1-prop-2-enylpyrazole-4,5-diamine |
| PubChem CID | 67655592 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 1-prop-2-enylpyrazole-4,5-diamine |
| SMILES | C=CCn1ncc(N)c1N |
| InChI | InChI=1S/C6H10N4/c1-2-3-10-6(8)5(7)4-9-10/h2,4H,1,3,7-8H2 |
| InChIKey | BYSSJXTVLYTBQO-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enylpyrazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enylpyrazole-4,5-diamine?
The IUPAC name of 1-prop-2-enylpyrazole-4,5-diamine (CID 67655592) is 1-prop-2-enylpyrazole-4,5-diamine.
What is the SMILES notation for 1-prop-2-enylpyrazole-4,5-diamine?
The canonical SMILES for 1-prop-2-enylpyrazole-4,5-diamine is C=CCn1ncc(N)c1N.
What is the InChIKey of 1-prop-2-enylpyrazole-4,5-diamine?
The InChIKey is BYSSJXTVLYTBQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4/c1-2-3-10-6(8)5(7)4-9-10/h2,4H,1,3,7-8H2.
What are the key properties of 1-prop-2-enylpyrazole-4,5-diamine?
1-prop-2-enylpyrazole-4,5-diamine has a molecular weight of 138.17 g/mol, XLogP of 0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enylpyrazole-4,5-diamine is sourced from PubChem (CID 67655592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).