C9H18N4O — CID 58980428
1-(4,5-diaminopyrazol-1-yl)hexan-2-ol (PubChem CID 58980428) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is 1-(4,5-diaminopyrazol-1-yl)hexan-2-ol.
| Compound Name | 1-(4,5-diaminopyrazol-1-yl)hexan-2-ol |
|---|---|
| PubChem CID | 58980428 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 1-(4,5-diaminopyrazol-1-yl)hexan-2-ol |
| SMILES | CCCCC(O)Cn1ncc(N)c1N |
| InChI | InChI=1S/C9H18N4O/c1-2-3-4-7(14)6-13-9(11)8(10)5-12-13/h5,7,14H,2-4,6,10-11H2,1H3 |
| InChIKey | HZCVRXGTVNXYTH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |