About 1-(1-aminobutyl)pyrazole-4,5-diamine
1-(1-aminobutyl)pyrazole-4,5-diamine (PubChem CID 69439653) has the molecular formula C7H15N5
and a molecular weight of 169.23 g/mol. Its IUPAC name is 1-(1-aminobutyl)pyrazole-4,5-diamine.
Molecular Properties
| Compound Name | 1-(1-aminobutyl)pyrazole-4,5-diamine |
| PubChem CID | 69439653 |
| Molecular Formula | C7H15N5 |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 1-(1-aminobutyl)pyrazole-4,5-diamine |
| SMILES | CCCC(N)n1ncc(N)c1N |
| InChI | InChI=1S/C7H15N5/c1-2-3-6(9)12-7(10)5(8)4-11-12/h4,6H,2-3,8-10H2,1H3 |
| InChIKey | BRDMCPALUIJOBQ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 95.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1-aminobutyl)pyrazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-aminobutyl)pyrazole-4,5-diamine?
The IUPAC name of 1-(1-aminobutyl)pyrazole-4,5-diamine (CID 69439653) is 1-(1-aminobutyl)pyrazole-4,5-diamine.
What is the SMILES notation for 1-(1-aminobutyl)pyrazole-4,5-diamine?
The canonical SMILES for 1-(1-aminobutyl)pyrazole-4,5-diamine is CCCC(N)n1ncc(N)c1N.
What is the InChIKey of 1-(1-aminobutyl)pyrazole-4,5-diamine?
The InChIKey is BRDMCPALUIJOBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N5/c1-2-3-6(9)12-7(10)5(8)4-11-12/h4,6H,2-3,8-10H2,1H3.
What are the key properties of 1-(1-aminobutyl)pyrazole-4,5-diamine?
1-(1-aminobutyl)pyrazole-4,5-diamine has a molecular weight of 169.23 g/mol, XLogP of 0.30, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-aminobutyl)pyrazole-4,5-diamine is sourced from PubChem (CID 69439653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).