C7H15N5 — CID 69439653
1-(1-aminobutyl)pyrazole-4,5-diamine (PubChem CID 69439653) has the molecular formula C7H15N5 and a molecular weight of 169.23 g/mol. Its IUPAC name is 1-(1-aminobutyl)pyrazole-4,5-diamine.
| Compound Name | 1-(1-aminobutyl)pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 69439653 |
| Molecular Formula | C7H15N5 |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 1-(1-aminobutyl)pyrazole-4,5-diamine |
| SMILES | CCCC(N)n1ncc(N)c1N |
| InChI | InChI=1S/C7H15N5/c1-2-3-6(9)12-7(10)5(8)4-11-12/h4,6H,2-3,8-10H2,1H3 |
| InChIKey | BRDMCPALUIJOBQ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 95.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |