C12H22N8O2 — CID 160635766
4-nitro-1-propylpyrazol-5-amine;1-propylpyrazole-4,5-diamine (PubChem CID 160635766) has the molecular formula C12H22N8O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 4-nitro-1-propylpyrazol-5-amine;1-propylpyrazole-4,5-diamine.
| Compound Name | 4-nitro-1-propylpyrazol-5-amine;1-propylpyrazole-4,5-diamine |
|---|---|
| PubChem CID | 160635766 |
| Molecular Formula | C12H22N8O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 4-nitro-1-propylpyrazol-5-amine;1-propylpyrazole-4,5-diamine |
| SMILES | CCCn1ncc(N)c1N.CCCn1ncc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C6H10N4O2.C6H12N4/c1-2-3-9-6(7)5(4-8-9)10(11)12;1-2-3-10-6(8)5(7)4-9-10/h4H,2-3,7H2,1H3;4H,2-3,7-8H2,1H3 |
| InChIKey | RINCDOYLHASWIK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 156.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|