C8H16N4O — CID 58913917
1-(3-methoxybutyl)pyrazole-4,5-diamine (PubChem CID 58913917) has the molecular formula C8H16N4O and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-(3-methoxybutyl)pyrazole-4,5-diamine.
| Compound Name | 1-(3-methoxybutyl)pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 58913917 |
| Molecular Formula | C8H16N4O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 1-(3-methoxybutyl)pyrazole-4,5-diamine |
| SMILES | COC(C)CCn1ncc(N)c1N |
| InChI | InChI=1S/C8H16N4O/c1-6(13-2)3-4-12-8(10)7(9)5-11-12/h5-6H,3-4,9-10H2,1-2H3 |
| InChIKey | QMIZYKXDFILFFH-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |