C12H18N4O3 — CID 68563050
2-(4,5-diaminopyrazol-1-yl)ethanol;2-methylbenzene-1,3-diol (PubChem CID 68563050) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(4,5-diaminopyrazol-1-yl)ethanol;2-methylbenzene-1,3-diol.
| Compound Name | 2-(4,5-diaminopyrazol-1-yl)ethanol;2-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 68563050 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-(4,5-diaminopyrazol-1-yl)ethanol;2-methylbenzene-1,3-diol |
| SMILES | Cc1c(O)cccc1O.Nc1cnn(CCO)c1N |
| InChI | InChI=1S/C7H8O2.C5H10N4O/c1-5-6(8)3-2-4-7(5)9;6-4-3-8-9(1-2-10)5(4)7/h2-4,8-9H,1H3;3,10H,1-2,6-7H2 |
| InChIKey | RXUREYJVWSFFHP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |