C7H14N4O2 — CID 22918623
2-[[4-amino-1-(2-hydroxyethyl)pyrazol-5-yl]amino]ethanol (PubChem CID 22918623) has the molecular formula C7H14N4O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-[[4-amino-1-(2-hydroxyethyl)pyrazol-5-yl]amino]ethanol.
| Compound Name | 2-[[4-amino-1-(2-hydroxyethyl)pyrazol-5-yl]amino]ethanol |
|---|---|
| PubChem CID | 22918623 |
| Molecular Formula | C7H14N4O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 2-[[4-amino-1-(2-hydroxyethyl)pyrazol-5-yl]amino]ethanol |
| SMILES | Nc1cnn(CCO)c1NCCO |
| InChI | InChI=1S/C7H14N4O2/c8-6-5-10-11(2-4-13)7(6)9-1-3-12/h5,9,12-13H,1-4,8H2 |
| InChIKey | JJIDNISCWDVNGB-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |