C8H14N4O5S — CID 58914019
2-[[4-amino-1-(3-sulfopropyl)pyrazol-5-yl]amino]acetic acid (PubChem CID 58914019) has the molecular formula C8H14N4O5S and a molecular weight of 278.29 g/mol. Its IUPAC name is 2-[[4-amino-1-(3-sulfopropyl)pyrazol-5-yl]amino]acetic acid.
| Compound Name | 2-[[4-amino-1-(3-sulfopropyl)pyrazol-5-yl]amino]acetic acid |
|---|---|
| PubChem CID | 58914019 |
| Molecular Formula | C8H14N4O5S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-[[4-amino-1-(3-sulfopropyl)pyrazol-5-yl]amino]acetic acid |
| SMILES | Nc1cnn(CCCS(=O)(=O)O)c1NCC(=O)O |
| InChI | InChI=1S/C8H14N4O5S/c9-6-4-11-12(2-1-3-18(15,16)17)8(6)10-5-7(13)14/h4,10H,1-3,5,9H2,(H,13,14)(H,15,16,17) |
| InChIKey | QNNILMMWHLPIRC-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|