C9H18N6O4S — CID 21040033
2-[4-amino-5-[2-aminoethyl-(2-amino-2-oxoethyl)amino]pyrazol-1-yl]ethanesulfonic acid (PubChem CID 21040033) has the molecular formula C9H18N6O4S and a molecular weight of 306.35 g/mol. Its IUPAC name is 2-[4-amino-5-[2-aminoethyl-(2-amino-2-oxoethyl)amino]pyrazol-1-yl]ethanesulfonic acid.
| Compound Name | 2-[4-amino-5-[2-aminoethyl-(2-amino-2-oxoethyl)amino]pyrazol-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 21040033 |
| Molecular Formula | C9H18N6O4S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-[4-amino-5-[2-aminoethyl-(2-amino-2-oxoethyl)amino]pyrazol-1-yl]ethanesulfonic acid |
| SMILES | NCCN(CC(N)=O)c1c(N)cnn1CCS(=O)(=O)O |
| InChI | InChI=1S/C9H18N6O4S/c10-1-2-14(6-8(12)16)9-7(11)5-13-15(9)3-4-20(17,18)19/h5H,1-4,6,10-11H2,(H2,12,16)(H,17,18,19) |
| InChIKey | RMDPANHFVZCGOB-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 170.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|