C9H19N5O — CID 58913962
5-N-(2-aminoethyl)-1-(3-methoxypropyl)pyrazole-4,5-diamine (PubChem CID 58913962) has the molecular formula C9H19N5O and a molecular weight of 213.28 g/mol. Its IUPAC name is 5-N-(2-aminoethyl)-1-(3-methoxypropyl)pyrazole-4,5-diamine.
| Compound Name | 5-N-(2-aminoethyl)-1-(3-methoxypropyl)pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 58913962 |
| Molecular Formula | C9H19N5O |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 5-N-(2-aminoethyl)-1-(3-methoxypropyl)pyrazole-4,5-diamine |
| SMILES | COCCCn1ncc(N)c1NCCN |
| InChI | InChI=1S/C9H19N5O/c1-15-6-2-5-14-9(12-4-3-10)8(11)7-13-14/h7,12H,2-6,10-11H2,1H3 |
| InChIKey | NKBXJYWNVJFDHU-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|