C12H24N6O — CID 58914000
2-[4-[2-[4-amino-5-(methylamino)pyrazol-1-yl]ethyl]piperazin-1-yl]ethanol (PubChem CID 58914000) has the molecular formula C12H24N6O and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-[4-[2-[4-amino-5-(methylamino)pyrazol-1-yl]ethyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[2-[4-amino-5-(methylamino)pyrazol-1-yl]ethyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 58914000 |
| Molecular Formula | C12H24N6O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 2-[4-[2-[4-amino-5-(methylamino)pyrazol-1-yl]ethyl]piperazin-1-yl]ethanol |
| SMILES | CNc1c(N)cnn1CCN1CCN(CCO)CC1 |
| InChI | InChI=1S/C12H24N6O/c1-14-12-11(13)10-15-18(12)7-6-16-2-4-17(5-3-16)8-9-19/h10,14,19H,2-9,13H2,1H3 |
| InChIKey | LELYZTXHPOVNGJ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 82.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |