C10H18BN3O3 — CID 68547617
2-[4-amino-5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyrazol-1-yl]ethanol (PubChem CID 68547617) has the molecular formula C10H18BN3O3 and a molecular weight of 239.08 g/mol. Its IUPAC name is 2-[4-amino-5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyrazol-1-yl]ethanol.
| Compound Name | 2-[4-amino-5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 68547617 |
| Molecular Formula | C10H18BN3O3 |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-[4-amino-5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyrazol-1-yl]ethanol |
| SMILES | CC1(C)COB(c2c(N)cnn2CCO)OC1 |
| InChI | InChI=1S/C10H18BN3O3/c1-10(2)6-16-11(17-7-10)9-8(12)5-13-14(9)3-4-15/h5,15H,3-4,6-7,12H2,1-2H3 |
| InChIKey | QQWWSNDZHXTKDE-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|