2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite

C5H12N4O5S — CID 163507816

IUPAC2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite
SMILESNc1cnn(CCO)c1N.O=S(O)OO
InChIInChI=1S/C5H10N4O.H2O4S/c6-4-3-8-9(1-2-10)5(4)7;1-4-5(2)3/h3,10H,1-2,6-7H2;1H,(H,2,3)
InChIKeyDAAWVCBSNWGUIL-UHFFFAOYSA-N
MW240.24 g/mol
LogP-1.35
Rot. Bonds3

About 2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite

2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite (PubChem CID 163507816) has the molecular formula C5H12N4O5S and a molecular weight of 240.24 g/mol. Its IUPAC name is 2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite.

Molecular Properties

Compound Name2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite
PubChem CID163507816
Molecular FormulaC5H12N4O5S
Molecular Weight240.24 g/mol
Exact Mass240.05
IUPAC Name2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite
SMILESNc1cnn(CCO)c1N.O=S(O)OO
InChIInChI=1S/C5H10N4O.H2O4S/c6-4-3-8-9(1-2-10)5(4)7;1-4-5(2)3/h3,10H,1-2,6-7H2;1H,(H,2,3)
InChIKeyDAAWVCBSNWGUIL-UHFFFAOYSA-N
XLogP-1.35
TPSA156.85 Ų
H-Bond Donors5
H-Bond Acceptors8
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.24
LogP ≤ 5-1.35
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite?
The IUPAC name of 2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite (CID 163507816) is 2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite.
What is the SMILES notation for 2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite?
The canonical SMILES for 2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite is Nc1cnn(CCO)c1N.O=S(O)OO.
What is the InChIKey of 2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite?
The InChIKey is DAAWVCBSNWGUIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4O.H2O4S/c6-4-3-8-9(1-2-10)5(4)7;1-4-5(2)3/h3,10H,1-2,6-7H2;1H,(H,2,3).
What are the key properties of 2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite?
2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite has a molecular weight of 240.24 g/mol, XLogP of -1.35, 3 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite is sourced from PubChem (CID 163507816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).