C5H12N4O5S — CID 163507816
2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite (PubChem CID 163507816) has the molecular formula C5H12N4O5S and a molecular weight of 240.24 g/mol. Its IUPAC name is 2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite.
| Compound Name | 2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite |
|---|---|
| PubChem CID | 163507816 |
| Molecular Formula | C5H12N4O5S |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-(4,5-diaminopyrazol-1-yl)ethanol;hydroxy hydrogen sulfite |
| SMILES | Nc1cnn(CCO)c1N.O=S(O)OO |
| InChI | InChI=1S/C5H10N4O.H2O4S/c6-4-3-8-9(1-2-10)5(4)7;1-4-5(2)3/h3,10H,1-2,6-7H2;1H,(H,2,3) |
| InChIKey | DAAWVCBSNWGUIL-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 156.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|