C8H16N4O2 — CID 58980398
1-(4,5-diaminopyrazol-1-yl)pentane-2,3-diol (PubChem CID 58980398) has the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 1-(4,5-diaminopyrazol-1-yl)pentane-2,3-diol.
| Compound Name | 1-(4,5-diaminopyrazol-1-yl)pentane-2,3-diol |
|---|---|
| PubChem CID | 58980398 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 1-(4,5-diaminopyrazol-1-yl)pentane-2,3-diol |
| SMILES | CCC(O)C(O)Cn1ncc(N)c1N |
| InChI | InChI=1S/C8H16N4O2/c1-2-6(13)7(14)4-12-8(10)5(9)3-11-12/h3,6-7,13-14H,2,4,9-10H2,1H3 |
| InChIKey | JVRQVAPPXFMUSD-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |