C11H22N4O2 — CID 59000041
1-[4-amino-5-(4-hydroxybutylamino)pyrazol-1-yl]butan-2-ol (PubChem CID 59000041) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-[4-amino-5-(4-hydroxybutylamino)pyrazol-1-yl]butan-2-ol.
| Compound Name | 1-[4-amino-5-(4-hydroxybutylamino)pyrazol-1-yl]butan-2-ol |
|---|---|
| PubChem CID | 59000041 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 1-[4-amino-5-(4-hydroxybutylamino)pyrazol-1-yl]butan-2-ol |
| SMILES | CCC(O)Cn1ncc(N)c1NCCCCO |
| InChI | InChI=1S/C11H22N4O2/c1-2-9(17)8-15-11(10(12)7-14-15)13-5-3-4-6-16/h7,9,13,16-17H,2-6,8,12H2,1H3 |
| InChIKey | DOUWQWNASVIVKL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|