C10H20N4O — CID 107316439
5-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]pentan-1-ol (PubChem CID 107316439) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is 5-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]pentan-1-ol.
| Compound Name | 5-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 107316439 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 5-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]pentan-1-ol |
| SMILES | Cc1nn(C)c(NCCCCCO)c1N |
| InChI | InChI=1S/C10H20N4O/c1-8-9(11)10(14(2)13-8)12-6-4-3-5-7-15/h12,15H,3-7,11H2,1-2H3 |
| InChIKey | GGNGANZQYZGMQZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|