C12H26ClN5O — CID 22392220
3-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]propyl-(2-hydroxyethyl)-dimethylazanium chloride (PubChem CID 22392220) has the molecular formula C12H26ClN5O and a molecular weight of 291.83 g/mol. Its IUPAC name is 3-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]propyl-(2-hydroxyethyl)-dimethylazanium chloride.
| Compound Name | 3-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]propyl-(2-hydroxyethyl)-dimethylazanium chloride |
|---|---|
| PubChem CID | 22392220 |
| Molecular Formula | C12H26ClN5O |
| Molecular Weight | 291.83 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 3-[(4-amino-1,3-dimethylpyrazol-5-yl)amino]propyl-(2-hydroxyethyl)-dimethylazanium chloride |
| SMILES | Cc1nn(C)c(NCCC[N+](C)(C)CCO)c1N.[Cl-] |
| InChI | InChI=1S/C12H26N5O.ClH/c1-10-11(13)12(16(2)15-10)14-6-5-7-17(3,4)8-9-18;/h14,18H,5-9,13H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | XGYIPYAEPGFNDQ-UHFFFAOYSA-M |
| XLogP | -2.81 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.83 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|