C7H12BN3O2 — CID 68545024
5-(1,3,2-dioxaborolan-2-yl)-1-ethylpyrazol-4-amine (PubChem CID 68545024) has the molecular formula C7H12BN3O2 and a molecular weight of 181.00 g/mol. Its IUPAC name is 5-(1,3,2-dioxaborolan-2-yl)-1-ethylpyrazol-4-amine.
| Compound Name | 5-(1,3,2-dioxaborolan-2-yl)-1-ethylpyrazol-4-amine |
|---|---|
| PubChem CID | 68545024 |
| Molecular Formula | C7H12BN3O2 |
| Molecular Weight | 181.00 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 5-(1,3,2-dioxaborolan-2-yl)-1-ethylpyrazol-4-amine |
| SMILES | CCn1ncc(N)c1B1OCCO1 |
| InChI | InChI=1S/C7H12BN3O2/c1-2-11-7(6(9)5-10-11)8-12-3-4-13-8/h5H,2-4,9H2,1H3 |
| InChIKey | BHOBSJPJAFYXEV-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.00 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|