C10H11N5 — CID 70499449
1-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-amine (PubChem CID 70499449) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is 1-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-amine.
| Compound Name | 1-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 70499449 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 1-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-amine |
| SMILES | C=CCn1nc(N)nc1-c1cccnc1 |
| InChI | InChI=1S/C10H11N5/c1-2-6-15-9(13-10(11)14-15)8-4-3-5-12-7-8/h2-5,7H,1,6H2,(H2,11,14) |
| InChIKey | QZPWTAYAEBSWNU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|