C9H9ClN4S — CID 72720922
4-chloro-6-methylsulfanyl-1-prop-2-enylpyrazolo[5,4-d]pyrimidine (PubChem CID 72720922) has the molecular formula C9H9ClN4S and a molecular weight of 240.72 g/mol. Its IUPAC name is 4-chloro-6-methylsulfanyl-1-prop-2-enylpyrazolo[5,4-d]pyrimidine.
| Compound Name | 4-chloro-6-methylsulfanyl-1-prop-2-enylpyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 72720922 |
| Molecular Formula | C9H9ClN4S |
| Molecular Weight | 240.72 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 4-chloro-6-methylsulfanyl-1-prop-2-enylpyrazolo[5,4-d]pyrimidine |
| SMILES | C=CCn1ncc2c(Cl)nc(SC)nc21 |
| InChI | InChI=1S/C9H9ClN4S/c1-3-4-14-8-6(5-11-14)7(10)12-9(13-8)15-2/h3,5H,1,4H2,2H3 |
| InChIKey | SQHSNKRBHHQHTA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.72 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|