C16H17ClN4S2 — CID 142715152
1-benzyl-4-(3-chloropropylsulfanyl)-6-methylsulfanylpyrazolo[5,4-d]pyrimidine (PubChem CID 142715152) has the molecular formula C16H17ClN4S2 and a molecular weight of 364.93 g/mol. Its IUPAC name is 1-benzyl-4-(3-chloropropylsulfanyl)-6-methylsulfanylpyrazolo[5,4-d]pyrimidine.
| Compound Name | 1-benzyl-4-(3-chloropropylsulfanyl)-6-methylsulfanylpyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 142715152 |
| Molecular Formula | C16H17ClN4S2 |
| Molecular Weight | 364.93 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 1-benzyl-4-(3-chloropropylsulfanyl)-6-methylsulfanylpyrazolo[5,4-d]pyrimidine |
| SMILES | CSc1nc(SCCCCl)c2cnn(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C16H17ClN4S2/c1-22-16-19-14-13(15(20-16)23-9-5-8-17)10-18-21(14)11-12-6-3-2-4-7-12/h2-4,6-7,10H,5,8-9,11H2,1H3 |
| InChIKey | WRVYNZFSIINFJR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.93 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|