About 1-methyl-5-methylsulfanyl-1,2,4-triazol-3-amine
1-methyl-5-methylsulfanyl-1,2,4-triazol-3-amine (PubChem CID 522820) has the molecular formula C4H8N4S
and a molecular weight of 144.20 g/mol. Its IUPAC name is 1-methyl-5-methylsulfanyl-1,2,4-triazol-3-amine.
Analyze 1-methyl-5-methylsulfanyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-methylsulfanyl-1,2,4-triazol-3-amine?
The IUPAC name of 1-methyl-5-methylsulfanyl-1,2,4-triazol-3-amine (CID 522820) is 1-methyl-5-methylsulfanyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 1-methyl-5-methylsulfanyl-1,2,4-triazol-3-amine?
The canonical SMILES for 1-methyl-5-methylsulfanyl-1,2,4-triazol-3-amine is CSc1nc(N)nn1C.
What is the InChIKey of 1-methyl-5-methylsulfanyl-1,2,4-triazol-3-amine?
The InChIKey is GHBGCSIFUKEXTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4S/c1-8-4(9-2)6-3(5)7-8/h1-2H3,(H2,5,7).
What are the key properties of 1-methyl-5-methylsulfanyl-1,2,4-triazol-3-amine?
1-methyl-5-methylsulfanyl-1,2,4-triazol-3-amine has a molecular weight of 144.20 g/mol, XLogP of 0.12, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-methylsulfanyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 522820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).