C3H5ClN4 — CID 14221624
5-chloro-1-methyl-1,2,4-triazol-3-amine (PubChem CID 14221624) has the molecular formula C3H5ClN4 and a molecular weight of 132.55 g/mol. Its IUPAC name is 5-chloro-1-methyl-1,2,4-triazol-3-amine.
| Compound Name | 5-chloro-1-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 14221624 |
| Molecular Formula | C3H5ClN4 |
| Molecular Weight | 132.55 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | 5-chloro-1-methyl-1,2,4-triazol-3-amine |
| SMILES | Cn1nc(N)nc1Cl |
| InChI | InChI=1S/C3H5ClN4/c1-8-2(4)6-3(5)7-8/h1H3,(H2,5,7) |
| InChIKey | YPVSHERVUKNWKP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.55 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |