About 5-chloro-2-methyl-1,2,4-triazol-3-amine;hydrochloride
5-chloro-2-methyl-1,2,4-triazol-3-amine;hydrochloride (PubChem CID 75530994) has the molecular formula C3H6Cl2N4
and a molecular weight of 169.02 g/mol. Its IUPAC name is 5-chloro-2-methyl-1,2,4-triazol-3-amine;hydrochloride.
Analyze 5-chloro-2-methyl-1,2,4-triazol-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-methyl-1,2,4-triazol-3-amine;hydrochloride?
The IUPAC name of 5-chloro-2-methyl-1,2,4-triazol-3-amine;hydrochloride (CID 75530994) is 5-chloro-2-methyl-1,2,4-triazol-3-amine;hydrochloride.
What is the SMILES notation for 5-chloro-2-methyl-1,2,4-triazol-3-amine;hydrochloride?
The canonical SMILES for 5-chloro-2-methyl-1,2,4-triazol-3-amine;hydrochloride is Cl.Cn1nc(Cl)nc1N.
What is the InChIKey of 5-chloro-2-methyl-1,2,4-triazol-3-amine;hydrochloride?
The InChIKey is YOQNRXMLTVAJDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5ClN4.ClH/c1-8-3(5)6-2(4)7-8;/h1H3,(H2,5,6,7);1H.
What are the key properties of 5-chloro-2-methyl-1,2,4-triazol-3-amine;hydrochloride?
5-chloro-2-methyl-1,2,4-triazol-3-amine;hydrochloride has a molecular weight of 169.02 g/mol, XLogP of 0.47, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methyl-1,2,4-triazol-3-amine;hydrochloride is sourced from PubChem (CID 75530994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).