C5H8N8S — CID 170854652
2-hydrazinyl-7-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-amine (PubChem CID 170854652) has the molecular formula C5H8N8S and a molecular weight of 212.24 g/mol. Its IUPAC name is 2-hydrazinyl-7-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-amine.
| Compound Name | 2-hydrazinyl-7-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-amine |
|---|---|
| PubChem CID | 170854652 |
| Molecular Formula | C5H8N8S |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 2-hydrazinyl-7-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-amine |
| SMILES | CSc1nc(N)nc2nc(NN)nn12 |
| InChI | InChI=1S/C5H8N8S/c1-14-5-9-2(6)8-4-10-3(11-7)12-13(4)5/h7H2,1H3,(H3,6,8,10,11,12) |
| InChIKey | KTWWXHVEKUNPOG-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 120.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|