About 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine
5,7-dichloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 97290091) has the molecular formula C5H3Cl2N5
and a molecular weight of 204.02 g/mol. Its IUPAC name is 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
Analyze 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine?
The IUPAC name of 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (CID 97290091) is 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
What is the SMILES notation for 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine?
The canonical SMILES for 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine is Nc1nc2nc(Cl)cc(Cl)n2n1.
What is the InChIKey of 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine?
The InChIKey is DZQKBFWGQQYJGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3Cl2N5/c6-2-1-3(7)12-5(9-2)10-4(8)11-12/h1H,(H2,8,11).
What are the key properties of 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine?
5,7-dichloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine has a molecular weight of 204.02 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine is sourced from PubChem (CID 97290091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).