C10H11IN4O2S2 — CID 25047142
4-iodo-N-(1-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)benzenesulfonamide (PubChem CID 25047142) has the molecular formula C10H11IN4O2S2 and a molecular weight of 410.26 g/mol. Its IUPAC name is 4-iodo-N-(1-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)benzenesulfonamide.
| Compound Name | 4-iodo-N-(1-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 25047142 |
| Molecular Formula | C10H11IN4O2S2 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.94 |
| IUPAC Name | 4-iodo-N-(1-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)benzenesulfonamide |
| SMILES | CSc1nc(NS(=O)(=O)c2ccc(I)cc2)nn1C |
| InChI | InChI=1S/C10H11IN4O2S2/c1-15-10(18-2)12-9(13-15)14-19(16,17)8-5-3-7(11)4-6-8/h3-6H,1-2H3,(H,13,14) |
| InChIKey | LHVCZBQPPLDZRZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|