C9H13N3S — CID 67425384
5-methyl-1-prop-2-enyl-3-prop-2-enylsulfanyl-1,2,4-triazole (PubChem CID 67425384) has the molecular formula C9H13N3S and a molecular weight of 195.29 g/mol. Its IUPAC name is 5-methyl-1-prop-2-enyl-3-prop-2-enylsulfanyl-1,2,4-triazole.
| Compound Name | 5-methyl-1-prop-2-enyl-3-prop-2-enylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 67425384 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 5-methyl-1-prop-2-enyl-3-prop-2-enylsulfanyl-1,2,4-triazole |
| SMILES | C=CCSc1nc(C)n(CC=C)n1 |
| InChI | InChI=1S/C9H13N3S/c1-4-6-12-8(3)10-9(11-12)13-7-5-2/h4-5H,1-2,6-7H2,3H3 |
| InChIKey | ZOWBFJMNJMMEBZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|