C21H17BrN4O2S — CID 134064809
2-[2-[[5-(4-bromophenyl)-1-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]isoindole-1,3-dione (PubChem CID 134064809) has the molecular formula C21H17BrN4O2S and a molecular weight of 469.36 g/mol. Its IUPAC name is 2-[2-[[5-(4-bromophenyl)-1-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[[5-(4-bromophenyl)-1-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134064809 |
| Molecular Formula | C21H17BrN4O2S |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | 2-[2-[[5-(4-bromophenyl)-1-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]isoindole-1,3-dione |
| SMILES | C=CCn1nc(SCCN2C(=O)c3ccccc3C2=O)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H17BrN4O2S/c1-2-11-26-18(14-7-9-15(22)10-8-14)23-21(24-26)29-13-12-25-19(27)16-5-3-4-6-17(16)20(25)28/h2-10H,1,11-13H2 |
| InChIKey | FUQIOHQEUABXMN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|