C9H12ClN3S — CID 47096172
3-(2-chloroprop-2-enylsulfanyl)-5-methyl-4-prop-2-enyl-1,2,4-triazole (PubChem CID 47096172) has the molecular formula C9H12ClN3S and a molecular weight of 229.74 g/mol. Its IUPAC name is 3-(2-chloroprop-2-enylsulfanyl)-5-methyl-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-(2-chloroprop-2-enylsulfanyl)-5-methyl-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 47096172 |
| Molecular Formula | C9H12ClN3S |
| Molecular Weight | 229.74 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 3-(2-chloroprop-2-enylsulfanyl)-5-methyl-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(C)nnc1SCC(=C)Cl |
| InChI | InChI=1S/C9H12ClN3S/c1-4-5-13-8(3)11-12-9(13)14-6-7(2)10/h4H,1-2,5-6H2,3H3 |
| InChIKey | LWPYNCJITSDWJH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.74 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|