C14H16ClN3S — CID 60603452
3-[2-(2-chlorophenyl)ethylsulfanyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole (PubChem CID 60603452) has the molecular formula C14H16ClN3S and a molecular weight of 293.82 g/mol. Its IUPAC name is 3-[2-(2-chlorophenyl)ethylsulfanyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[2-(2-chlorophenyl)ethylsulfanyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 60603452 |
| Molecular Formula | C14H16ClN3S |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-[2-(2-chlorophenyl)ethylsulfanyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(C)nnc1SCCc1ccccc1Cl |
| InChI | InChI=1S/C14H16ClN3S/c1-3-9-18-11(2)16-17-14(18)19-10-8-12-6-4-5-7-13(12)15/h3-7H,1,8-10H2,2H3 |
| InChIKey | BNZOBOXBCAAUPB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|