C15H16Cl2N4OS — CID 17136467
N-(2,5-dichlorophenyl)-3-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 17136467) has the molecular formula C15H16Cl2N4OS and a molecular weight of 371.29 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-3-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-(2,5-dichlorophenyl)-3-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 17136467 |
| Molecular Formula | C15H16Cl2N4OS |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | N-(2,5-dichlorophenyl)-3-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | C=CCn1c(C)nnc1SCCC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H16Cl2N4OS/c1-3-7-21-10(2)19-20-15(21)23-8-6-14(22)18-13-9-11(16)4-5-12(13)17/h3-5,9H,1,6-8H2,2H3,(H,18,22) |
| InChIKey | NDFDIYMEAUIONQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|