C18H16Cl2N4O2S — CID 4785141
N-(2,5-dichlorophenyl)-2-[[5-(3-methylfuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4785141) has the molecular formula C18H16Cl2N4O2S and a molecular weight of 423.33 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[[5-(3-methylfuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[[5-(3-methylfuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4785141 |
| Molecular Formula | C18H16Cl2N4O2S |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[[5-(3-methylfuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(Cl)ccc2Cl)nnc1-c1occc1C |
| InChI | InChI=1S/C18H16Cl2N4O2S/c1-3-7-24-17(16-11(2)6-8-26-16)22-23-18(24)27-10-15(25)21-14-9-12(19)4-5-13(14)20/h3-6,8-9H,1,7,10H2,2H3,(H,21,25) |
| InChIKey | JCSDVFFONUEOIC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|