C10H15N5O2S — CID 47135637
N-carbamoyl-3-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 47135637) has the molecular formula C10H15N5O2S and a molecular weight of 269.33 g/mol. Its IUPAC name is N-carbamoyl-3-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-carbamoyl-3-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 47135637 |
| Molecular Formula | C10H15N5O2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-carbamoyl-3-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | C=CCn1c(C)nnc1SCCC(=O)NC(N)=O |
| InChI | InChI=1S/C10H15N5O2S/c1-3-5-15-7(2)13-14-10(15)18-6-4-8(16)12-9(11)17/h3H,1,4-6H2,2H3,(H3,11,12,16,17) |
| InChIKey | SOPVRCFWPDQFJG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|