C14H13Cl2N3OS — CID 78764227
1-(3,4-dichlorophenyl)-2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethanone (PubChem CID 78764227) has the molecular formula C14H13Cl2N3OS and a molecular weight of 342.25 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethanone.
| Compound Name | 1-(3,4-dichlorophenyl)-2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 78764227 |
| Molecular Formula | C14H13Cl2N3OS |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| SMILES | C=CCn1c(C)nnc1SCC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2N3OS/c1-3-6-19-9(2)17-18-14(19)21-8-13(20)10-4-5-11(15)12(16)7-10/h3-5,7H,1,6,8H2,2H3 |
| InChIKey | QILZRESDAREGMM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|