C13H12FN3O2S2 — CID 11865289
(Z)-3-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-4-hydroxypent-3-en-2-one (PubChem CID 11865289) has the molecular formula C13H12FN3O2S2 and a molecular weight of 325.39 g/mol. Its IUPAC name is (Z)-3-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-4-hydroxypent-3-en-2-one.
| Compound Name | (Z)-3-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-4-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 11865289 |
| Molecular Formula | C13H12FN3O2S2 |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | (Z)-3-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-4-hydroxypent-3-en-2-one |
| SMILES | CC(=O)/C(Sc1nnc(Nc2ccccc2F)s1)=C(\C)O |
| InChI | InChI=1S/C13H12FN3O2S2/c1-7(18)11(8(2)19)20-13-17-16-12(21-13)15-10-6-4-3-5-9(10)14/h3-6,18H,1-2H3,(H,15,16)/b11-7- |
| InChIKey | QMETYRWGUCMYQB-XFFZJAGNSA-N |
| XLogP | 3.89 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|