C20H22FN5OS2 — CID 3888301
N-[4-(diethylamino)phenyl]-2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 3888301) has the molecular formula C20H22FN5OS2 and a molecular weight of 431.56 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[4-(diethylamino)phenyl]-2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3888301 |
| Molecular Formula | C20H22FN5OS2 |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CSc2nnc(Nc3ccccc3F)s2)cc1 |
| InChI | InChI=1S/C20H22FN5OS2/c1-3-26(4-2)15-11-9-14(10-12-15)22-18(27)13-28-20-25-24-19(29-20)23-17-8-6-5-7-16(17)21/h5-12H,3-4,13H2,1-2H3,(H,22,27)(H,23,24) |
| InChIKey | NNVCTERDZYHWRU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|