C14H19N5OS2 — CID 2115070
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(diethylamino)phenyl]acetamide (PubChem CID 2115070) has the molecular formula C14H19N5OS2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(diethylamino)phenyl]acetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(diethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 2115070 |
| Molecular Formula | C14H19N5OS2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(diethylamino)phenyl]acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CSc2nnc(N)s2)cc1 |
| InChI | InChI=1S/C14H19N5OS2/c1-3-19(4-2)11-7-5-10(6-8-11)16-12(20)9-21-14-18-17-13(15)22-14/h5-8H,3-4,9H2,1-2H3,(H2,15,17)(H,16,20) |
| InChIKey | IAKNOMWXYMEOGI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|