C16H10Cl3FN4OS2 — CID 3527865
2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 3527865) has the molecular formula C16H10Cl3FN4OS2 and a molecular weight of 463.77 g/mol. Its IUPAC name is 2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 3527865 |
| Molecular Formula | C16H10Cl3FN4OS2 |
| Molecular Weight | 463.77 g/mol |
| Exact Mass | 461.93 |
| IUPAC Name | 2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(CSc1nnc(Nc2ccccc2F)s1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H10Cl3FN4OS2/c17-8-5-10(19)13(6-9(8)18)21-14(25)7-26-16-24-23-15(27-16)22-12-4-2-1-3-11(12)20/h1-6H,7H2,(H,21,25)(H,22,23) |
| InChIKey | ZKCHTUDWJRRLRW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.77 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|