C18H22BrN3OS — CID 118654253
[4-(bromomethyl)thiophen-2-yl]-[4-[[(1S,3S,4S)-3-ethyl-4-methylcyclopentyl]amino]pyrimidin-5-yl]methanone (PubChem CID 118654253) has the molecular formula C18H22BrN3OS and a molecular weight of 408.37 g/mol. Its IUPAC name is [4-(bromomethyl)thiophen-2-yl]-[4-[[(1S,3S,4S)-3-ethyl-4-methylcyclopentyl]amino]pyrimidin-5-yl]methanone.
| Compound Name | [4-(bromomethyl)thiophen-2-yl]-[4-[[(1S,3S,4S)-3-ethyl-4-methylcyclopentyl]amino]pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 118654253 |
| Molecular Formula | C18H22BrN3OS |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | [4-(bromomethyl)thiophen-2-yl]-[4-[[(1S,3S,4S)-3-ethyl-4-methylcyclopentyl]amino]pyrimidin-5-yl]methanone |
| SMILES | CC[C@H]1C[C@@H](Nc2ncncc2C(=O)c2cc(CBr)cs2)C[C@@H]1C |
| InChI | InChI=1S/C18H22BrN3OS/c1-3-13-6-14(4-11(13)2)22-18-15(8-20-10-21-18)17(23)16-5-12(7-19)9-24-16/h5,8-11,13-14H,3-4,6-7H2,1-2H3,(H,20,21,22)/t11-,13-,14-/m0/s1 |
| InChIKey | KIUQZDDADWAJQH-UBHSHLNASA-N |
| XLogP | 4.90 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|