C17H22N4O3S2 — CID 144991795
[4-[[3-(aminosulfanyloxymethyl)cyclopentyl]amino]pyrimidin-5-yl]-[4-(methoxymethyl)thiophen-2-yl]methanone (PubChem CID 144991795) has the molecular formula C17H22N4O3S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is [4-[[3-(aminosulfanyloxymethyl)cyclopentyl]amino]pyrimidin-5-yl]-[4-(methoxymethyl)thiophen-2-yl]methanone.
| Compound Name | [4-[[3-(aminosulfanyloxymethyl)cyclopentyl]amino]pyrimidin-5-yl]-[4-(methoxymethyl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 144991795 |
| Molecular Formula | C17H22N4O3S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | [4-[[3-(aminosulfanyloxymethyl)cyclopentyl]amino]pyrimidin-5-yl]-[4-(methoxymethyl)thiophen-2-yl]methanone |
| SMILES | COCc1csc(C(=O)c2cncnc2NC2CCC(COSN)C2)c1 |
| InChI | InChI=1S/C17H22N4O3S2/c1-23-7-12-5-15(25-9-12)16(22)14-6-19-10-20-17(14)21-13-3-2-11(4-13)8-24-26-18/h5-6,9-11,13H,2-4,7-8,18H2,1H3,(H,19,20,21) |
| InChIKey | XPLFZQGYTOGWAJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|