C16H19ClN4O3S2 — CID 144991352
[4-[[3-(aminosulfanyloxymethyl)cyclopentyl]amino]pyrimidin-5-yl]-[5-chloro-4-(hydroxymethyl)thiophen-2-yl]methanone (PubChem CID 144991352) has the molecular formula C16H19ClN4O3S2 and a molecular weight of 414.94 g/mol. Its IUPAC name is [4-[[3-(aminosulfanyloxymethyl)cyclopentyl]amino]pyrimidin-5-yl]-[5-chloro-4-(hydroxymethyl)thiophen-2-yl]methanone.
| Compound Name | [4-[[3-(aminosulfanyloxymethyl)cyclopentyl]amino]pyrimidin-5-yl]-[5-chloro-4-(hydroxymethyl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 144991352 |
| Molecular Formula | C16H19ClN4O3S2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | [4-[[3-(aminosulfanyloxymethyl)cyclopentyl]amino]pyrimidin-5-yl]-[5-chloro-4-(hydroxymethyl)thiophen-2-yl]methanone |
| SMILES | NSOCC1CCC(Nc2ncncc2C(=O)c2cc(CO)c(Cl)s2)C1 |
| InChI | InChI=1S/C16H19ClN4O3S2/c17-15-10(6-22)4-13(25-15)14(23)12-5-19-8-20-16(12)21-11-2-1-9(3-11)7-24-26-18/h4-5,8-9,11,22H,1-3,6-7,18H2,(H,19,20,21) |
| InChIKey | DRIJAPCRYIRFQX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|