C22H32N4O2S2 — CID 144991766
[4-[3-(aminosulfanyloxymethyl)pentylamino]pyrimidin-5-yl]-[4-(cyclohexylmethyl)thiophen-2-yl]methanone (PubChem CID 144991766) has the molecular formula C22H32N4O2S2 and a molecular weight of 448.66 g/mol. Its IUPAC name is [4-[3-(aminosulfanyloxymethyl)pentylamino]pyrimidin-5-yl]-[4-(cyclohexylmethyl)thiophen-2-yl]methanone.
| Compound Name | [4-[3-(aminosulfanyloxymethyl)pentylamino]pyrimidin-5-yl]-[4-(cyclohexylmethyl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 144991766 |
| Molecular Formula | C22H32N4O2S2 |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | [4-[3-(aminosulfanyloxymethyl)pentylamino]pyrimidin-5-yl]-[4-(cyclohexylmethyl)thiophen-2-yl]methanone |
| SMILES | CCC(CCNc1ncncc1C(=O)c1cc(CC2CCCCC2)cs1)COSN |
| InChI | InChI=1S/C22H32N4O2S2/c1-2-16(13-28-30-23)8-9-25-22-19(12-24-15-26-22)21(27)20-11-18(14-29-20)10-17-6-4-3-5-7-17/h11-12,14-17H,2-10,13,23H2,1H3,(H,24,25,26) |
| InChIKey | CYSIPDCADRUECR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|