C23H28N4O3S2 — CID 144991411
[4-[3-(aminosulfanyloxymethyl)pentylamino]pyrimidin-5-yl]-[4-[(2-methylphenoxy)methyl]thiophen-2-yl]methanone (PubChem CID 144991411) has the molecular formula C23H28N4O3S2 and a molecular weight of 472.64 g/mol. Its IUPAC name is [4-[3-(aminosulfanyloxymethyl)pentylamino]pyrimidin-5-yl]-[4-[(2-methylphenoxy)methyl]thiophen-2-yl]methanone.
| Compound Name | [4-[3-(aminosulfanyloxymethyl)pentylamino]pyrimidin-5-yl]-[4-[(2-methylphenoxy)methyl]thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 144991411 |
| Molecular Formula | C23H28N4O3S2 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | [4-[3-(aminosulfanyloxymethyl)pentylamino]pyrimidin-5-yl]-[4-[(2-methylphenoxy)methyl]thiophen-2-yl]methanone |
| SMILES | CCC(CCNc1ncncc1C(=O)c1cc(COc2ccccc2C)cs1)COSN |
| InChI | InChI=1S/C23H28N4O3S2/c1-3-17(13-30-32-24)8-9-26-23-19(11-25-15-27-23)22(28)21-10-18(14-31-21)12-29-20-7-5-4-6-16(20)2/h4-7,10-11,14-15,17H,3,8-9,12-13,24H2,1-2H3,(H,25,26,27) |
| InChIKey | YRQCXTSSABLVEF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|