About 1-(2-cyclopropyl-1,3-thiazol-5-yl)-N-methylmethanimine
1-(2-cyclopropyl-1,3-thiazol-5-yl)-N-methylmethanimine (PubChem CID 118654672) has the molecular formula C8H10N2S
and a molecular weight of 166.25 g/mol. Its IUPAC name is 1-(2-cyclopropyl-1,3-thiazol-5-yl)-N-methylmethanimine.
Molecular Properties
| Compound Name | 1-(2-cyclopropyl-1,3-thiazol-5-yl)-N-methylmethanimine |
| PubChem CID | 118654672 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 1-(2-cyclopropyl-1,3-thiazol-5-yl)-N-methylmethanimine |
| SMILES | C/N=C/c1cnc(C2CC2)s1 |
| InChI | InChI=1S/C8H10N2S/c1-9-4-7-5-10-8(11-7)6-2-3-6/h4-6H,2-3H2,1H3/b9-4+ |
| InChIKey | JTOIXOMMKHYKOF-RUDMXATFSA-N |
| XLogP | 2.07 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-cyclopropyl-1,3-thiazol-5-yl)-N-methylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclopropyl-1,3-thiazol-5-yl)-N-methylmethanimine?
The IUPAC name of 1-(2-cyclopropyl-1,3-thiazol-5-yl)-N-methylmethanimine (CID 118654672) is 1-(2-cyclopropyl-1,3-thiazol-5-yl)-N-methylmethanimine.
What is the SMILES notation for 1-(2-cyclopropyl-1,3-thiazol-5-yl)-N-methylmethanimine?
The canonical SMILES for 1-(2-cyclopropyl-1,3-thiazol-5-yl)-N-methylmethanimine is C/N=C/c1cnc(C2CC2)s1.
What is the InChIKey of 1-(2-cyclopropyl-1,3-thiazol-5-yl)-N-methylmethanimine?
The InChIKey is JTOIXOMMKHYKOF-RUDMXATFSA-N. The full InChI is InChI=1S/C8H10N2S/c1-9-4-7-5-10-8(11-7)6-2-3-6/h4-6H,2-3H2,1H3/b9-4+.
What are the key properties of 1-(2-cyclopropyl-1,3-thiazol-5-yl)-N-methylmethanimine?
1-(2-cyclopropyl-1,3-thiazol-5-yl)-N-methylmethanimine has a molecular weight of 166.25 g/mol, XLogP of 2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclopropyl-1,3-thiazol-5-yl)-N-methylmethanimine is sourced from PubChem (CID 118654672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).