C29H29Cl2F2N3O10S2 — CID 118654676
[(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 4-(3-sulfamoylphenyl)sulfonylmorpholine-2-carboxylate (PubChem CID 118654676) has the molecular formula C29H29Cl2F2N3O10S2 and a molecular weight of 752.60 g/mol. Its IUPAC name is [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 4-(3-sulfamoylphenyl)sulfonylmorpholine-2-carboxylate.
| Compound Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 4-(3-sulfamoylphenyl)sulfonylmorpholine-2-carboxylate |
|---|---|
| PubChem CID | 118654676 |
| Molecular Formula | C29H29Cl2F2N3O10S2 |
| Molecular Weight | 752.60 g/mol |
| Exact Mass | 751.06 |
| IUPAC Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 4-(3-sulfamoylphenyl)sulfonylmorpholine-2-carboxylate |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)N2CCOC(C(=O)O[C@@H](Cc3c(Cl)c[n+]([O-])cc3Cl)c3ccc(OC(F)F)c(OCC4CC4)c3)C2)c1 |
| InChI | InChI=1S/C29H29Cl2F2N3O10S2/c30-22-13-35(38)14-23(31)21(22)12-25(18-6-7-24(46-29(32)33)26(10-18)44-16-17-4-5-17)45-28(37)27-15-36(8-9-43-27)48(41,42)20-3-1-2-19(11-20)47(34,39)40/h1-3,6-7,10-11,13-14,17,25,27,29H,4-5,8-9,12,15-16H2,(H2,34,39,40)/t25-,27?/m0/s1 |
| InChIKey | MVULVXYYDIEBTJ-PVCWFJFTSA-N |
| XLogP | 3.58 |
| TPSA | 178.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|