C25H21NOS — CID 118655521
1-(11,11-dimethyl-6-phenylthieno[2,3-a]acridin-2-yl)ethanone (PubChem CID 118655521) has the molecular formula C25H21NOS and a molecular weight of 383.52 g/mol. Its IUPAC name is 1-(11,11-dimethyl-6-phenylthieno[2,3-a]acridin-2-yl)ethanone.
| Compound Name | 1-(11,11-dimethyl-6-phenylthieno[2,3-a]acridin-2-yl)ethanone |
|---|---|
| PubChem CID | 118655521 |
| Molecular Formula | C25H21NOS |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 1-(11,11-dimethyl-6-phenylthieno[2,3-a]acridin-2-yl)ethanone |
| SMILES | CC(=O)c1cc2ccc3c(c2s1)C(C)(C)c1ccccc1N3c1ccccc1 |
| InChI | InChI=1S/C25H21NOS/c1-16(27)22-15-17-13-14-21-23(24(17)28-22)25(2,3)19-11-7-8-12-20(19)26(21)18-9-5-4-6-10-18/h4-15H,1-3H3 |
| InChIKey | PMHLPCVMIWXCQN-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |