C16H28N4O6 — CID 11865651
(1S,3S,4R,5R)-N-(2-amino-2-oxoethyl)-3-(cyclohexylcarbamoylamino)-1,4,5-trihydroxycyclohexane-1-carboxamide (PubChem CID 11865651) has the molecular formula C16H28N4O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is (1S,3S,4R,5R)-N-(2-amino-2-oxoethyl)-3-(cyclohexylcarbamoylamino)-1,4,5-trihydroxycyclohexane-1-carboxamide.
| Compound Name | (1S,3S,4R,5R)-N-(2-amino-2-oxoethyl)-3-(cyclohexylcarbamoylamino)-1,4,5-trihydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11865651 |
| Molecular Formula | C16H28N4O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (1S,3S,4R,5R)-N-(2-amino-2-oxoethyl)-3-(cyclohexylcarbamoylamino)-1,4,5-trihydroxycyclohexane-1-carboxamide |
| SMILES | NC(=O)CNC(=O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)NC2CCCCC2)C1 |
| InChI | InChI=1S/C16H28N4O6/c17-12(22)8-18-14(24)16(26)6-10(13(23)11(21)7-16)20-15(25)19-9-4-2-1-3-5-9/h9-11,13,21,23,26H,1-8H2,(H2,17,22)(H,18,24)(H2,19,20,25)/t10-,11+,13+,16-/m0/s1 |
| InChIKey | SOFKNPJWARYBQE-IQDSPRDJSA-N |
| XLogP | -2.16 |
| TPSA | 174.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |